C15H21F3N4O — CID 86772335
N-(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-2-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 86772335) has the molecular formula C15H21F3N4O and a molecular weight of 330.35 g/mol. Its IUPAC name is N-(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-2-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 86772335 |
| Molecular Formula | C15H21F3N4O |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | N-(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | Cc1nnc2n1CC(NC(=O)C1CCCCC1C(F)(F)F)CC2 |
| InChI | InChI=1S/C15H21F3N4O/c1-9-20-21-13-7-6-10(8-22(9)13)19-14(23)11-4-2-3-5-12(11)15(16,17)18/h10-12H,2-8H2,1H3,(H,19,23) |
| InChIKey | PBUKHWZLJVFIGA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |