C17H26N6O — CID 86772442
1-tert-butyl-N-(3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-5-methylpyrazole-3-carboxamide (PubChem CID 86772442) has the molecular formula C17H26N6O and a molecular weight of 330.44 g/mol. Its IUPAC name is 1-tert-butyl-N-(3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-5-methylpyrazole-3-carboxamide.
| Compound Name | 1-tert-butyl-N-(3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 86772442 |
| Molecular Formula | C17H26N6O |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 1-tert-butyl-N-(3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-5-methylpyrazole-3-carboxamide |
| SMILES | CCc1nnc2n1CC(NC(=O)c1cc(C)n(C(C)(C)C)n1)CC2 |
| InChI | InChI=1S/C17H26N6O/c1-6-14-19-20-15-8-7-12(10-22(14)15)18-16(24)13-9-11(2)23(21-13)17(3,4)5/h9,12H,6-8,10H2,1-5H3,(H,18,24) |
| InChIKey | BDUGLUHPPFNADO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |