C12H16F3N3O2 — CID 86772694
N-(2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl)-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 86772694) has the molecular formula C12H16F3N3O2 and a molecular weight of 291.27 g/mol. Its IUPAC name is N-(2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl)-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-(2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl)-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 86772694 |
| Molecular Formula | C12H16F3N3O2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | N-(2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl)-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | Cc1cn2c(n1)CCC(NC(=O)COCC(F)(F)F)C2 |
| InChI | InChI=1S/C12H16F3N3O2/c1-8-4-18-5-9(2-3-10(18)16-8)17-11(19)6-20-7-12(13,14)15/h4,9H,2-3,5-7H2,1H3,(H,17,19) |
| InChIKey | KJHYTRXPHBFZGA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |