C16H23N7O — CID 86772880
3-methyl-N-[(2-morpholin-4-ylpyrimidin-5-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine (PubChem CID 86772880) has the molecular formula C16H23N7O and a molecular weight of 329.41 g/mol. Its IUPAC name is 3-methyl-N-[(2-morpholin-4-ylpyrimidin-5-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine.
| Compound Name | 3-methyl-N-[(2-morpholin-4-ylpyrimidin-5-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine |
|---|---|
| PubChem CID | 86772880 |
| Molecular Formula | C16H23N7O |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 3-methyl-N-[(2-morpholin-4-ylpyrimidin-5-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine |
| SMILES | Cc1nnc2n1CC(NCc1cnc(N3CCOCC3)nc1)CC2 |
| InChI | InChI=1S/C16H23N7O/c1-12-20-21-15-3-2-14(11-23(12)15)17-8-13-9-18-16(19-10-13)22-4-6-24-7-5-22/h9-10,14,17H,2-8,11H2,1H3 |
| InChIKey | VKFZNOLJMMJPKR-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |