C19H21FN4O — CID 86772927
3-ethyl-N-[[5-(2-fluorophenyl)furan-2-yl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine (PubChem CID 86772927) has the molecular formula C19H21FN4O and a molecular weight of 340.40 g/mol. Its IUPAC name is 3-ethyl-N-[[5-(2-fluorophenyl)furan-2-yl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine.
| Compound Name | 3-ethyl-N-[[5-(2-fluorophenyl)furan-2-yl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine |
|---|---|
| PubChem CID | 86772927 |
| Molecular Formula | C19H21FN4O |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 3-ethyl-N-[[5-(2-fluorophenyl)furan-2-yl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine |
| SMILES | CCc1nnc2n1CC(NCc1ccc(-c3ccccc3F)o1)CC2 |
| InChI | InChI=1S/C19H21FN4O/c1-2-18-22-23-19-10-7-13(12-24(18)19)21-11-14-8-9-17(25-14)15-5-3-4-6-16(15)20/h3-6,8-9,13,21H,2,7,10-12H2,1H3 |
| InChIKey | PLKZFDMLTQPXEE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |