C14H19ClN4S — CID 86772945
N-[(5-chlorothiophen-2-yl)methyl]-3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine (PubChem CID 86772945) has the molecular formula C14H19ClN4S and a molecular weight of 310.85 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine |
|---|---|
| PubChem CID | 86772945 |
| Molecular Formula | C14H19ClN4S |
| Molecular Weight | 310.85 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine |
| SMILES | CC(C)c1nnc2n1CC(NCc1ccc(Cl)s1)CC2 |
| InChI | InChI=1S/C14H19ClN4S/c1-9(2)14-18-17-13-6-3-10(8-19(13)14)16-7-11-4-5-12(15)20-11/h4-5,9-10,16H,3,6-8H2,1-2H3 |
| InChIKey | NGPUWDTXOVMPLM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.85 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |