About [2-(3-fluorophenyl)-2-oxoethyl] 2-ethylsulfonylbenzoate
[2-(3-fluorophenyl)-2-oxoethyl] 2-ethylsulfonylbenzoate (PubChem CID 8677319) has the molecular formula C17H15FO5S
and a molecular weight of 350.37 g/mol. Its IUPAC name is [2-(3-fluorophenyl)-2-oxoethyl] 2-ethylsulfonylbenzoate.
Molecular Properties
| Compound Name | [2-(3-fluorophenyl)-2-oxoethyl] 2-ethylsulfonylbenzoate |
| PubChem CID | 8677319 |
| Molecular Formula | C17H15FO5S |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | [2-(3-fluorophenyl)-2-oxoethyl] 2-ethylsulfonylbenzoate |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)OCC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C17H15FO5S/c1-2-24(21,22)16-9-4-3-8-14(16)17(20)23-11-15(19)12-6-5-7-13(18)10-12/h3-10H,2,11H2,1H3 |
| InChIKey | RJPJZIJGQTUGLW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(3-fluorophenyl)-2-oxoethyl] 2-ethylsulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-fluorophenyl)-2-oxoethyl] 2-ethylsulfonylbenzoate?
The IUPAC name of [2-(3-fluorophenyl)-2-oxoethyl] 2-ethylsulfonylbenzoate (CID 8677319) is [2-(3-fluorophenyl)-2-oxoethyl] 2-ethylsulfonylbenzoate.
What is the SMILES notation for [2-(3-fluorophenyl)-2-oxoethyl] 2-ethylsulfonylbenzoate?
The canonical SMILES for [2-(3-fluorophenyl)-2-oxoethyl] 2-ethylsulfonylbenzoate is CCS(=O)(=O)c1ccccc1C(=O)OCC(=O)c1cccc(F)c1.
What is the InChIKey of [2-(3-fluorophenyl)-2-oxoethyl] 2-ethylsulfonylbenzoate?
The InChIKey is RJPJZIJGQTUGLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15FO5S/c1-2-24(21,22)16-9-4-3-8-14(16)17(20)23-11-15(19)12-6-5-7-13(18)10-12/h3-10H,2,11H2,1H3.
What are the key properties of [2-(3-fluorophenyl)-2-oxoethyl] 2-ethylsulfonylbenzoate?
[2-(3-fluorophenyl)-2-oxoethyl] 2-ethylsulfonylbenzoate has a molecular weight of 350.37 g/mol, XLogP of 2.66, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-fluorophenyl)-2-oxoethyl] 2-ethylsulfonylbenzoate is sourced from PubChem (CID 8677319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).