About 4-[6-(cyclohexylmethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]morpholine
4-[6-(cyclohexylmethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]morpholine (PubChem CID 86773294) has the molecular formula C18H28N4O
and a molecular weight of 316.45 g/mol. Its IUPAC name is 4-[6-(cyclohexylmethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]morpholine.
Molecular Properties
| Compound Name | 4-[6-(cyclohexylmethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]morpholine |
| PubChem CID | 86773294 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | 4-[6-(cyclohexylmethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]morpholine |
| SMILES | c1nc2c(c(N3CCOCC3)n1)CN(CC1CCCCC1)CC2 |
| InChI | InChI=1S/C18H28N4O/c1-2-4-15(5-3-1)12-21-7-6-17-16(13-21)18(20-14-19-17)22-8-10-23-11-9-22/h14-15H,1-13H2 |
| InChIKey | RRXVIHYOIWUBJU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[6-(cyclohexylmethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-(cyclohexylmethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]morpholine?
The IUPAC name of 4-[6-(cyclohexylmethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]morpholine (CID 86773294) is 4-[6-(cyclohexylmethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]morpholine.
What is the SMILES notation for 4-[6-(cyclohexylmethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]morpholine?
The canonical SMILES for 4-[6-(cyclohexylmethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]morpholine is c1nc2c(c(N3CCOCC3)n1)CN(CC1CCCCC1)CC2.
What is the InChIKey of 4-[6-(cyclohexylmethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]morpholine?
The InChIKey is RRXVIHYOIWUBJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N4O/c1-2-4-15(5-3-1)12-21-7-6-17-16(13-21)18(20-14-19-17)22-8-10-23-11-9-22/h14-15H,1-13H2.
What are the key properties of 4-[6-(cyclohexylmethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]morpholine?
4-[6-(cyclohexylmethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]morpholine has a molecular weight of 316.45 g/mol, XLogP of 2.25, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-(cyclohexylmethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]morpholine is sourced from PubChem (CID 86773294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).