About N-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidin-3-yl)methyl]pyridin-2-amine
N-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidin-3-yl)methyl]pyridin-2-amine (PubChem CID 86773701) has the molecular formula C16H17N5S
and a molecular weight of 311.41 g/mol. Its IUPAC name is N-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidin-3-yl)methyl]pyridin-2-amine.
Molecular Properties
| Compound Name | N-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidin-3-yl)methyl]pyridin-2-amine |
| PubChem CID | 86773701 |
| Molecular Formula | C16H17N5S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | N-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidin-3-yl)methyl]pyridin-2-amine |
| SMILES | c1ccc(NCC2CCN(c3ncnc4sccc34)C2)nc1 |
| InChI | InChI=1S/C16H17N5S/c1-2-6-17-14(3-1)18-9-12-4-7-21(10-12)15-13-5-8-22-16(13)20-11-19-15/h1-3,5-6,8,11-12H,4,7,9-10H2,(H,17,18) |
| InChIKey | XHCVLBQCOOSYHN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidin-3-yl)methyl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidin-3-yl)methyl]pyridin-2-amine?
The IUPAC name of N-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidin-3-yl)methyl]pyridin-2-amine (CID 86773701) is N-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidin-3-yl)methyl]pyridin-2-amine.
What is the SMILES notation for N-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidin-3-yl)methyl]pyridin-2-amine?
The canonical SMILES for N-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidin-3-yl)methyl]pyridin-2-amine is c1ccc(NCC2CCN(c3ncnc4sccc34)C2)nc1.
What is the InChIKey of N-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidin-3-yl)methyl]pyridin-2-amine?
The InChIKey is XHCVLBQCOOSYHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N5S/c1-2-6-17-14(3-1)18-9-12-4-7-21(10-12)15-13-5-8-22-16(13)20-11-19-15/h1-3,5-6,8,11-12H,4,7,9-10H2,(H,17,18).
What are the key properties of N-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidin-3-yl)methyl]pyridin-2-amine?
N-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidin-3-yl)methyl]pyridin-2-amine has a molecular weight of 311.41 g/mol, XLogP of 3.02, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidin-3-yl)methyl]pyridin-2-amine is sourced from PubChem (CID 86773701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).