About 5-chloro-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)thiadiazole
5-chloro-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)thiadiazole (PubChem CID 86774655) has the molecular formula C9H10ClN5S
and a molecular weight of 255.73 g/mol. Its IUPAC name is 5-chloro-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)thiadiazole.
Molecular Properties
| Compound Name | 5-chloro-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)thiadiazole |
| PubChem CID | 86774655 |
| Molecular Formula | C9H10ClN5S |
| Molecular Weight | 255.73 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 5-chloro-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)thiadiazole |
| SMILES | Clc1snnc1CN1CCn2ccnc2C1 |
| InChI | InChI=1S/C9H10ClN5S/c10-9-7(12-13-16-9)5-14-3-4-15-2-1-11-8(15)6-14/h1-2H,3-6H2 |
| InChIKey | UQRCFCNHXOVSMC-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.73 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-chloro-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)thiadiazole?
The IUPAC name of 5-chloro-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)thiadiazole (CID 86774655) is 5-chloro-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)thiadiazole.
What is the SMILES notation for 5-chloro-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)thiadiazole?
The canonical SMILES for 5-chloro-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)thiadiazole is Clc1snnc1CN1CCn2ccnc2C1.
What is the InChIKey of 5-chloro-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)thiadiazole?
The InChIKey is UQRCFCNHXOVSMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClN5S/c10-9-7(12-13-16-9)5-14-3-4-15-2-1-11-8(15)6-14/h1-2H,3-6H2.
What are the key properties of 5-chloro-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)thiadiazole?
5-chloro-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)thiadiazole has a molecular weight of 255.73 g/mol, XLogP of 1.40, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)thiadiazole is sourced from PubChem (CID 86774655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).