About methyl 4-bromo-3,5-difluorobenzoate
methyl 4-bromo-3,5-difluorobenzoate (PubChem CID 86775235) has the molecular formula C8H5BrF2O2
and a molecular weight of 251.03 g/mol. Its IUPAC name is methyl 4-bromo-3,5-difluorobenzoate.
Molecular Properties
| Compound Name | methyl 4-bromo-3,5-difluorobenzoate |
| PubChem CID | 86775235 |
| Molecular Formula | C8H5BrF2O2 |
| Molecular Weight | 251.03 g/mol |
| Exact Mass | 249.94 |
| IUPAC Name | methyl 4-bromo-3,5-difluorobenzoate |
| SMILES | COC(=O)c1cc(F)c(Br)c(F)c1 |
| InChI | InChI=1S/C8H5BrF2O2/c1-13-8(12)4-2-5(10)7(9)6(11)3-4/h2-3H,1H3 |
| InChIKey | LJDAUJSNGVTBGT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.03 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-bromo-3,5-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-bromo-3,5-difluorobenzoate?
The IUPAC name of methyl 4-bromo-3,5-difluorobenzoate (CID 86775235) is methyl 4-bromo-3,5-difluorobenzoate.
What is the SMILES notation for methyl 4-bromo-3,5-difluorobenzoate?
The canonical SMILES for methyl 4-bromo-3,5-difluorobenzoate is COC(=O)c1cc(F)c(Br)c(F)c1.
What is the InChIKey of methyl 4-bromo-3,5-difluorobenzoate?
The InChIKey is LJDAUJSNGVTBGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrF2O2/c1-13-8(12)4-2-5(10)7(9)6(11)3-4/h2-3H,1H3.
What are the key properties of methyl 4-bromo-3,5-difluorobenzoate?
methyl 4-bromo-3,5-difluorobenzoate has a molecular weight of 251.03 g/mol, XLogP of 2.51, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-bromo-3,5-difluorobenzoate is sourced from PubChem (CID 86775235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).