About 4-amino-3-iodophenol;hydrochloride
4-amino-3-iodophenol;hydrochloride (PubChem CID 86775296) has the molecular formula C6H7ClINO
and a molecular weight of 271.49 g/mol. Its IUPAC name is 4-amino-3-iodophenol;hydrochloride.
Molecular Properties
| Compound Name | 4-amino-3-iodophenol;hydrochloride |
| PubChem CID | 86775296 |
| Molecular Formula | C6H7ClINO |
| Molecular Weight | 271.49 g/mol |
| Exact Mass | 270.93 |
| IUPAC Name | 4-amino-3-iodophenol;hydrochloride |
| SMILES | Cl.Nc1ccc(O)cc1I |
| InChI | InChI=1S/C6H6INO.ClH/c7-5-3-4(9)1-2-6(5)8;/h1-3,9H,8H2;1H |
| InChIKey | IQWVENNPUMLVQQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.49 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3-iodophenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-iodophenol;hydrochloride?
The IUPAC name of 4-amino-3-iodophenol;hydrochloride (CID 86775296) is 4-amino-3-iodophenol;hydrochloride.
What is the SMILES notation for 4-amino-3-iodophenol;hydrochloride?
The canonical SMILES for 4-amino-3-iodophenol;hydrochloride is Cl.Nc1ccc(O)cc1I.
What is the InChIKey of 4-amino-3-iodophenol;hydrochloride?
The InChIKey is IQWVENNPUMLVQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6INO.ClH/c7-5-3-4(9)1-2-6(5)8;/h1-3,9H,8H2;1H.
What are the key properties of 4-amino-3-iodophenol;hydrochloride?
4-amino-3-iodophenol;hydrochloride has a molecular weight of 271.49 g/mol, XLogP of 2.00, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-iodophenol;hydrochloride is sourced from PubChem (CID 86775296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).