About 7,8-dichloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride
7,8-dichloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride (PubChem CID 86775388) has the molecular formula C9H10Cl3NO
and a molecular weight of 254.54 g/mol. Its IUPAC name is 7,8-dichloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride.
Molecular Properties
| Compound Name | 7,8-dichloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| PubChem CID | 86775388 |
| Molecular Formula | C9H10Cl3NO |
| Molecular Weight | 254.54 g/mol |
| Exact Mass | 252.98 |
| IUPAC Name | 7,8-dichloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| SMILES | Cl.NC1CCOc2c1ccc(Cl)c2Cl |
| InChI | InChI=1S/C9H9Cl2NO.ClH/c10-6-2-1-5-7(12)3-4-13-9(5)8(6)11;/h1-2,7H,3-4,12H2;1H |
| InChIKey | VYJZOAGPDFHSJL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.54 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,8-dichloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dichloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride?
The IUPAC name of 7,8-dichloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CID 86775388) is 7,8-dichloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride.
What is the SMILES notation for 7,8-dichloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride?
The canonical SMILES for 7,8-dichloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride is Cl.NC1CCOc2c1ccc(Cl)c2Cl.
What is the InChIKey of 7,8-dichloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride?
The InChIKey is VYJZOAGPDFHSJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Cl2NO.ClH/c10-6-2-1-5-7(12)3-4-13-9(5)8(6)11;/h1-2,7H,3-4,12H2;1H.
What are the key properties of 7,8-dichloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride?
7,8-dichloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride has a molecular weight of 254.54 g/mol, XLogP of 3.20, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dichloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride is sourced from PubChem (CID 86775388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).