About 2-amino-5-(2-aminoethyl)benzene-1,4-diol;dihydrobromide
2-amino-5-(2-aminoethyl)benzene-1,4-diol;dihydrobromide (PubChem CID 86775405) has the molecular formula C8H14Br2N2O2
and a molecular weight of 330.02 g/mol. Its IUPAC name is 2-amino-5-(2-aminoethyl)benzene-1,4-diol;dihydrobromide.
Molecular Properties
| Compound Name | 2-amino-5-(2-aminoethyl)benzene-1,4-diol;dihydrobromide |
| PubChem CID | 86775405 |
| Molecular Formula | C8H14Br2N2O2 |
| Molecular Weight | 330.02 g/mol |
| Exact Mass | 327.94 |
| IUPAC Name | 2-amino-5-(2-aminoethyl)benzene-1,4-diol;dihydrobromide |
| SMILES | Br.Br.NCCc1cc(O)c(N)cc1O |
| InChI | InChI=1S/C8H12N2O2.2BrH/c9-2-1-5-3-8(12)6(10)4-7(5)11;;/h3-4,11-12H,1-2,9-10H2;2*1H |
| InChIKey | BJOHJBIGEJAXES-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.02 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-(2-aminoethyl)benzene-1,4-diol;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-(2-aminoethyl)benzene-1,4-diol;dihydrobromide?
The IUPAC name of 2-amino-5-(2-aminoethyl)benzene-1,4-diol;dihydrobromide (CID 86775405) is 2-amino-5-(2-aminoethyl)benzene-1,4-diol;dihydrobromide.
What is the SMILES notation for 2-amino-5-(2-aminoethyl)benzene-1,4-diol;dihydrobromide?
The canonical SMILES for 2-amino-5-(2-aminoethyl)benzene-1,4-diol;dihydrobromide is Br.Br.NCCc1cc(O)c(N)cc1O.
What is the InChIKey of 2-amino-5-(2-aminoethyl)benzene-1,4-diol;dihydrobromide?
The InChIKey is BJOHJBIGEJAXES-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2.2BrH/c9-2-1-5-3-8(12)6(10)4-7(5)11;;/h3-4,11-12H,1-2,9-10H2;2*1H.
What are the key properties of 2-amino-5-(2-aminoethyl)benzene-1,4-diol;dihydrobromide?
2-amino-5-(2-aminoethyl)benzene-1,4-diol;dihydrobromide has a molecular weight of 330.02 g/mol, XLogP of 1.34, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-(2-aminoethyl)benzene-1,4-diol;dihydrobromide is sourced from PubChem (CID 86775405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).