About 6-methyl-1,4-thiazepane 1-oxide;hydrochloride
6-methyl-1,4-thiazepane 1-oxide;hydrochloride (PubChem CID 86775590) has the molecular formula C6H14ClNOS
and a molecular weight of 183.70 g/mol. Its IUPAC name is 6-methyl-1,4-thiazepane 1-oxide;hydrochloride.
Molecular Properties
| Compound Name | 6-methyl-1,4-thiazepane 1-oxide;hydrochloride |
| PubChem CID | 86775590 |
| Molecular Formula | C6H14ClNOS |
| Molecular Weight | 183.70 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 6-methyl-1,4-thiazepane 1-oxide;hydrochloride |
| SMILES | CC1CNCCS(=O)C1.Cl |
| InChI | InChI=1S/C6H13NOS.ClH/c1-6-4-7-2-3-9(8)5-6;/h6-7H,2-5H2,1H3;1H |
| InChIKey | AGHVNFRMRFBCLR-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.70 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-1,4-thiazepane 1-oxide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1,4-thiazepane 1-oxide;hydrochloride?
The IUPAC name of 6-methyl-1,4-thiazepane 1-oxide;hydrochloride (CID 86775590) is 6-methyl-1,4-thiazepane 1-oxide;hydrochloride.
What is the SMILES notation for 6-methyl-1,4-thiazepane 1-oxide;hydrochloride?
The canonical SMILES for 6-methyl-1,4-thiazepane 1-oxide;hydrochloride is CC1CNCCS(=O)C1.Cl.
What is the InChIKey of 6-methyl-1,4-thiazepane 1-oxide;hydrochloride?
The InChIKey is AGHVNFRMRFBCLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NOS.ClH/c1-6-4-7-2-3-9(8)5-6;/h6-7H,2-5H2,1H3;1H.
What are the key properties of 6-methyl-1,4-thiazepane 1-oxide;hydrochloride?
6-methyl-1,4-thiazepane 1-oxide;hydrochloride has a molecular weight of 183.70 g/mol, XLogP of 0.40, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1,4-thiazepane 1-oxide;hydrochloride is sourced from PubChem (CID 86775590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).