About ethyl 1,3-dimethyl-2,4-dioxopyrimidine-5-carboxylate
ethyl 1,3-dimethyl-2,4-dioxopyrimidine-5-carboxylate (PubChem CID 86775671) has the molecular formula C9H12N2O4
and a molecular weight of 212.20 g/mol. Its IUPAC name is ethyl 1,3-dimethyl-2,4-dioxopyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 1,3-dimethyl-2,4-dioxopyrimidine-5-carboxylate |
| PubChem CID | 86775671 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | ethyl 1,3-dimethyl-2,4-dioxopyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C9H12N2O4/c1-4-15-8(13)6-5-10(2)9(14)11(3)7(6)12/h5H,4H2,1-3H3 |
| InChIKey | NBPWUCASXSGJQX-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 1,3-dimethyl-2,4-dioxopyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1,3-dimethyl-2,4-dioxopyrimidine-5-carboxylate?
The IUPAC name of ethyl 1,3-dimethyl-2,4-dioxopyrimidine-5-carboxylate (CID 86775671) is ethyl 1,3-dimethyl-2,4-dioxopyrimidine-5-carboxylate.
What is the SMILES notation for ethyl 1,3-dimethyl-2,4-dioxopyrimidine-5-carboxylate?
The canonical SMILES for ethyl 1,3-dimethyl-2,4-dioxopyrimidine-5-carboxylate is CCOC(=O)c1cn(C)c(=O)n(C)c1=O.
What is the InChIKey of ethyl 1,3-dimethyl-2,4-dioxopyrimidine-5-carboxylate?
The InChIKey is NBPWUCASXSGJQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O4/c1-4-15-8(13)6-5-10(2)9(14)11(3)7(6)12/h5H,4H2,1-3H3.
What are the key properties of ethyl 1,3-dimethyl-2,4-dioxopyrimidine-5-carboxylate?
ethyl 1,3-dimethyl-2,4-dioxopyrimidine-5-carboxylate has a molecular weight of 212.20 g/mol, XLogP of -0.74, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1,3-dimethyl-2,4-dioxopyrimidine-5-carboxylate is sourced from PubChem (CID 86775671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).