About N-ethyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-amine;dihydrochloride
N-ethyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-amine;dihydrochloride (PubChem CID 86775673) has the molecular formula C12H24Cl2N4O
and a molecular weight of 311.26 g/mol. Its IUPAC name is N-ethyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-amine;dihydrochloride.
Molecular Properties
| Compound Name | N-ethyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-amine;dihydrochloride |
| PubChem CID | 86775673 |
| Molecular Formula | C12H24Cl2N4O |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | N-ethyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-amine;dihydrochloride |
| SMILES | CCN(Cc1noc(C)n1)C1CCCNCC1.Cl.Cl |
| InChI | InChI=1S/C12H22N4O.2ClH/c1-3-16(9-12-14-10(2)17-15-12)11-5-4-7-13-8-6-11;;/h11,13H,3-9H2,1-2H3;2*1H |
| InChIKey | PJAJIOBJDUAVOO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-ethyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-amine;dihydrochloride?
The IUPAC name of N-ethyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-amine;dihydrochloride (CID 86775673) is N-ethyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-amine;dihydrochloride.
What is the SMILES notation for N-ethyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-amine;dihydrochloride?
The canonical SMILES for N-ethyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-amine;dihydrochloride is CCN(Cc1noc(C)n1)C1CCCNCC1.Cl.Cl.
What is the InChIKey of N-ethyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-amine;dihydrochloride?
The InChIKey is PJAJIOBJDUAVOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4O.2ClH/c1-3-16(9-12-14-10(2)17-15-12)11-5-4-7-13-8-6-11;;/h11,13H,3-9H2,1-2H3;2*1H.
What are the key properties of N-ethyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-amine;dihydrochloride?
N-ethyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-amine;dihydrochloride has a molecular weight of 311.26 g/mol, XLogP of 2.19, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-amine;dihydrochloride is sourced from PubChem (CID 86775673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).