About (2S)-2-N-(2,2-difluoroethyl)-2-N-ethylpropane-1,2-diamine
(2S)-2-N-(2,2-difluoroethyl)-2-N-ethylpropane-1,2-diamine (PubChem CID 86775689) has the molecular formula C7H16F2N2
and a molecular weight of 166.22 g/mol. Its IUPAC name is (2S)-2-N-(2,2-difluoroethyl)-2-N-ethylpropane-1,2-diamine.
Molecular Properties
| Compound Name | (2S)-2-N-(2,2-difluoroethyl)-2-N-ethylpropane-1,2-diamine |
| PubChem CID | 86775689 |
| Molecular Formula | C7H16F2N2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.13 |
| IUPAC Name | (2S)-2-N-(2,2-difluoroethyl)-2-N-ethylpropane-1,2-diamine |
| SMILES | CCN(CC(F)F)[C@@H](C)CN |
| InChI | InChI=1S/C7H16F2N2/c1-3-11(5-7(8)9)6(2)4-10/h6-7H,3-5,10H2,1-2H3/t6-/m0/s1 |
| InChIKey | GQYQDDQXOWLOOF-LURJTMIESA-N |
| XLogP | 0.92 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-N-(2,2-difluoroethyl)-2-N-ethylpropane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-N-(2,2-difluoroethyl)-2-N-ethylpropane-1,2-diamine?
The IUPAC name of (2S)-2-N-(2,2-difluoroethyl)-2-N-ethylpropane-1,2-diamine (CID 86775689) is (2S)-2-N-(2,2-difluoroethyl)-2-N-ethylpropane-1,2-diamine.
What is the SMILES notation for (2S)-2-N-(2,2-difluoroethyl)-2-N-ethylpropane-1,2-diamine?
The canonical SMILES for (2S)-2-N-(2,2-difluoroethyl)-2-N-ethylpropane-1,2-diamine is CCN(CC(F)F)[C@@H](C)CN.
What is the InChIKey of (2S)-2-N-(2,2-difluoroethyl)-2-N-ethylpropane-1,2-diamine?
The InChIKey is GQYQDDQXOWLOOF-LURJTMIESA-N. The full InChI is InChI=1S/C7H16F2N2/c1-3-11(5-7(8)9)6(2)4-10/h6-7H,3-5,10H2,1-2H3/t6-/m0/s1.
What are the key properties of (2S)-2-N-(2,2-difluoroethyl)-2-N-ethylpropane-1,2-diamine?
(2S)-2-N-(2,2-difluoroethyl)-2-N-ethylpropane-1,2-diamine has a molecular weight of 166.22 g/mol, XLogP of 0.92, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-N-(2,2-difluoroethyl)-2-N-ethylpropane-1,2-diamine is sourced from PubChem (CID 86775689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).