About (3Z)-6-chloro-3-(thiophen-2-ylmethylidene)-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one
(3Z)-6-chloro-3-(thiophen-2-ylmethylidene)-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one (PubChem CID 86775952) has the molecular formula C16H11ClN2OS
and a molecular weight of 314.80 g/mol. Its IUPAC name is (3Z)-6-chloro-3-(thiophen-2-ylmethylidene)-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one.
Molecular Properties
| Compound Name | (3Z)-6-chloro-3-(thiophen-2-ylmethylidene)-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one |
| PubChem CID | 86775952 |
| Molecular Formula | C16H11ClN2OS |
| Molecular Weight | 314.80 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | (3Z)-6-chloro-3-(thiophen-2-ylmethylidene)-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one |
| SMILES | O=c1c2ccc(Cl)cc2nc2n1CC/C2=C/c1cccs1 |
| InChI | InChI=1S/C16H11ClN2OS/c17-11-3-4-13-14(9-11)18-15-10(5-6-19(15)16(13)20)8-12-2-1-7-21-12/h1-4,7-9H,5-6H2/b10-8- |
| InChIKey | YISMYYJXOBLQMS-NTMALXAHSA-N |
| XLogP | 4.06 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.80 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3Z)-6-chloro-3-(thiophen-2-ylmethylidene)-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-6-chloro-3-(thiophen-2-ylmethylidene)-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one?
The IUPAC name of (3Z)-6-chloro-3-(thiophen-2-ylmethylidene)-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one (CID 86775952) is (3Z)-6-chloro-3-(thiophen-2-ylmethylidene)-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one.
What is the SMILES notation for (3Z)-6-chloro-3-(thiophen-2-ylmethylidene)-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one?
The canonical SMILES for (3Z)-6-chloro-3-(thiophen-2-ylmethylidene)-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one is O=c1c2ccc(Cl)cc2nc2n1CC/C2=C/c1cccs1.
What is the InChIKey of (3Z)-6-chloro-3-(thiophen-2-ylmethylidene)-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one?
The InChIKey is YISMYYJXOBLQMS-NTMALXAHSA-N. The full InChI is InChI=1S/C16H11ClN2OS/c17-11-3-4-13-14(9-11)18-15-10(5-6-19(15)16(13)20)8-12-2-1-7-21-12/h1-4,7-9H,5-6H2/b10-8-.
What are the key properties of (3Z)-6-chloro-3-(thiophen-2-ylmethylidene)-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one?
(3Z)-6-chloro-3-(thiophen-2-ylmethylidene)-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one has a molecular weight of 314.80 g/mol, XLogP of 4.06, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-6-chloro-3-(thiophen-2-ylmethylidene)-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one is sourced from PubChem (CID 86775952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).