About 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2,3-dimethylguanidine
1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2,3-dimethylguanidine (PubChem CID 86777199) has the molecular formula C11H20N4S
and a molecular weight of 240.38 g/mol. Its IUPAC name is 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2,3-dimethylguanidine.
Molecular Properties
| Compound Name | 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2,3-dimethylguanidine |
| PubChem CID | 86777199 |
| Molecular Formula | C11H20N4S |
| Molecular Weight | 240.38 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2,3-dimethylguanidine |
| SMILES | CCc1nc(CCN/C(=N/C)NC)sc1C |
| InChI | InChI=1S/C11H20N4S/c1-5-9-8(2)16-10(15-9)6-7-14-11(12-3)13-4/h5-7H2,1-4H3,(H2,12,13,14) |
| InChIKey | XIYTZPGKSABKAV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2,3-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2,3-dimethylguanidine?
The IUPAC name of 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2,3-dimethylguanidine (CID 86777199) is 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2,3-dimethylguanidine.
What is the SMILES notation for 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2,3-dimethylguanidine?
The canonical SMILES for 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2,3-dimethylguanidine is CCc1nc(CCN/C(=N/C)NC)sc1C.
What is the InChIKey of 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2,3-dimethylguanidine?
The InChIKey is XIYTZPGKSABKAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4S/c1-5-9-8(2)16-10(15-9)6-7-14-11(12-3)13-4/h5-7H2,1-4H3,(H2,12,13,14).
What are the key properties of 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2,3-dimethylguanidine?
1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2,3-dimethylguanidine has a molecular weight of 240.38 g/mol, XLogP of 1.35, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2,3-dimethylguanidine is sourced from PubChem (CID 86777199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).