C12H24IN3 — CID 86777332
2-(cyclohex-3-en-1-ylmethyl)-1,1,3,3-tetramethylguanidine;hydroiodide (PubChem CID 86777332) has the molecular formula C12H24IN3 and a molecular weight of 337.25 g/mol. Its IUPAC name is 2-(cyclohex-3-en-1-ylmethyl)-1,1,3,3-tetramethylguanidine;hydroiodide.
| Compound Name | 2-(cyclohex-3-en-1-ylmethyl)-1,1,3,3-tetramethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 86777332 |
| Molecular Formula | C12H24IN3 |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 2-(cyclohex-3-en-1-ylmethyl)-1,1,3,3-tetramethylguanidine;hydroiodide |
| SMILES | CN(C)C(=NCC1CC=CCC1)N(C)C.I |
| InChI | InChI=1S/C12H23N3.HI/c1-14(2)12(15(3)4)13-10-11-8-6-5-7-9-11;/h5-6,11H,7-10H2,1-4H3;1H |
| InChIKey | QFWMDTVSYTUKSO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|