C21H27ClN4OS — CID 8677784
1-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-3-cyclohexyl-1-cyclopentylthiourea (PubChem CID 8677784) has the molecular formula C21H27ClN4OS and a molecular weight of 418.99 g/mol. Its IUPAC name is 1-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-3-cyclohexyl-1-cyclopentylthiourea.
| Compound Name | 1-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-3-cyclohexyl-1-cyclopentylthiourea |
|---|---|
| PubChem CID | 8677784 |
| Molecular Formula | C21H27ClN4OS |
| Molecular Weight | 418.99 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 1-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-3-cyclohexyl-1-cyclopentylthiourea |
| SMILES | S=C(NC1CCCCC1)N(Cc1nnc(-c2ccc(Cl)cc2)o1)C1CCCC1 |
| InChI | InChI=1S/C21H27ClN4OS/c22-16-12-10-15(11-13-16)20-25-24-19(27-20)14-26(18-8-4-5-9-18)21(28)23-17-6-2-1-3-7-17/h10-13,17-18H,1-9,14H2,(H,23,28) |
| InChIKey | NFOGNOOOJREUDV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.99 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|