C13H24IN3 — CID 86777910
N-(2-cyclohexylcyclopropyl)-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide (PubChem CID 86777910) has the molecular formula C13H24IN3 and a molecular weight of 349.26 g/mol. Its IUPAC name is N-(2-cyclohexylcyclopropyl)-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide.
| Compound Name | N-(2-cyclohexylcyclopropyl)-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 86777910 |
| Molecular Formula | C13H24IN3 |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-(2-cyclohexylcyclopropyl)-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
| SMILES | C1CCC(C2CC2NC2=NCCCN2)CC1.I |
| InChI | InChI=1S/C13H23N3.HI/c1-2-5-10(6-3-1)11-9-12(11)16-13-14-7-4-8-15-13;/h10-12H,1-9H2,(H2,14,15,16);1H |
| InChIKey | CNFLACVPSZODLL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|