C13H21F3N2O — CID 86778017
1-(3-methylbut-2-enyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide (PubChem CID 86778017) has the molecular formula C13H21F3N2O and a molecular weight of 278.32 g/mol. Its IUPAC name is 1-(3-methylbut-2-enyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide.
| Compound Name | 1-(3-methylbut-2-enyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 86778017 |
| Molecular Formula | C13H21F3N2O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 1-(3-methylbut-2-enyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
| SMILES | CC(C)=CCN1CCCC(C(=O)NCC(F)(F)F)C1 |
| InChI | InChI=1S/C13H21F3N2O/c1-10(2)5-7-18-6-3-4-11(8-18)12(19)17-9-13(14,15)16/h5,11H,3-4,6-9H2,1-2H3,(H,17,19) |
| InChIKey | CDEMOHKNJYTRDO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|