About 1H-indazol-7-ylmethyl 1-methyl-5-propan-2-ylpyrazole-3-carboxylate
1H-indazol-7-ylmethyl 1-methyl-5-propan-2-ylpyrazole-3-carboxylate (PubChem CID 86778213) has the molecular formula C16H18N4O2
and a molecular weight of 298.35 g/mol. Its IUPAC name is 1H-indazol-7-ylmethyl 1-methyl-5-propan-2-ylpyrazole-3-carboxylate.
Molecular Properties
| Compound Name | 1H-indazol-7-ylmethyl 1-methyl-5-propan-2-ylpyrazole-3-carboxylate |
| PubChem CID | 86778213 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 1H-indazol-7-ylmethyl 1-methyl-5-propan-2-ylpyrazole-3-carboxylate |
| SMILES | CC(C)c1cc(C(=O)OCc2cccc3cn[nH]c23)nn1C |
| InChI | InChI=1S/C16H18N4O2/c1-10(2)14-7-13(19-20(14)3)16(21)22-9-12-6-4-5-11-8-17-18-15(11)12/h4-8,10H,9H2,1-3H3,(H,17,18) |
| InChIKey | DKJBOSRFLFEYAO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1H-indazol-7-ylmethyl 1-methyl-5-propan-2-ylpyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indazol-7-ylmethyl 1-methyl-5-propan-2-ylpyrazole-3-carboxylate?
The IUPAC name of 1H-indazol-7-ylmethyl 1-methyl-5-propan-2-ylpyrazole-3-carboxylate (CID 86778213) is 1H-indazol-7-ylmethyl 1-methyl-5-propan-2-ylpyrazole-3-carboxylate.
What is the SMILES notation for 1H-indazol-7-ylmethyl 1-methyl-5-propan-2-ylpyrazole-3-carboxylate?
The canonical SMILES for 1H-indazol-7-ylmethyl 1-methyl-5-propan-2-ylpyrazole-3-carboxylate is CC(C)c1cc(C(=O)OCc2cccc3cn[nH]c23)nn1C.
What is the InChIKey of 1H-indazol-7-ylmethyl 1-methyl-5-propan-2-ylpyrazole-3-carboxylate?
The InChIKey is DKJBOSRFLFEYAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4O2/c1-10(2)14-7-13(19-20(14)3)16(21)22-9-12-6-4-5-11-8-17-18-15(11)12/h4-8,10H,9H2,1-3H3,(H,17,18).
What are the key properties of 1H-indazol-7-ylmethyl 1-methyl-5-propan-2-ylpyrazole-3-carboxylate?
1H-indazol-7-ylmethyl 1-methyl-5-propan-2-ylpyrazole-3-carboxylate has a molecular weight of 298.35 g/mol, XLogP of 2.78, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indazol-7-ylmethyl 1-methyl-5-propan-2-ylpyrazole-3-carboxylate is sourced from PubChem (CID 86778213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).