About 1,2-dimethyl-3-[[3-(trifluoromethyl)cyclohexyl]methyl]guanidine;hydroiodide
1,2-dimethyl-3-[[3-(trifluoromethyl)cyclohexyl]methyl]guanidine;hydroiodide (PubChem CID 86778670) has the molecular formula C11H21F3IN3
and a molecular weight of 379.21 g/mol. Its IUPAC name is 1,2-dimethyl-3-[[3-(trifluoromethyl)cyclohexyl]methyl]guanidine;hydroiodide.
Molecular Properties
| Compound Name | 1,2-dimethyl-3-[[3-(trifluoromethyl)cyclohexyl]methyl]guanidine;hydroiodide |
| PubChem CID | 86778670 |
| Molecular Formula | C11H21F3IN3 |
| Molecular Weight | 379.21 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 1,2-dimethyl-3-[[3-(trifluoromethyl)cyclohexyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NC)NCC1CCCC(C(F)(F)F)C1.I |
| InChI | InChI=1S/C11H20F3N3.HI/c1-15-10(16-2)17-7-8-4-3-5-9(6-8)11(12,13)14;/h8-9H,3-7H2,1-2H3,(H2,15,16,17);1H |
| InChIKey | BMRYDGSZGTVFSP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.21 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethyl-3-[[3-(trifluoromethyl)cyclohexyl]methyl]guanidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-3-[[3-(trifluoromethyl)cyclohexyl]methyl]guanidine;hydroiodide?
The IUPAC name of 1,2-dimethyl-3-[[3-(trifluoromethyl)cyclohexyl]methyl]guanidine;hydroiodide (CID 86778670) is 1,2-dimethyl-3-[[3-(trifluoromethyl)cyclohexyl]methyl]guanidine;hydroiodide.
What is the SMILES notation for 1,2-dimethyl-3-[[3-(trifluoromethyl)cyclohexyl]methyl]guanidine;hydroiodide?
The canonical SMILES for 1,2-dimethyl-3-[[3-(trifluoromethyl)cyclohexyl]methyl]guanidine;hydroiodide is C/N=C(\NC)NCC1CCCC(C(F)(F)F)C1.I.
What is the InChIKey of 1,2-dimethyl-3-[[3-(trifluoromethyl)cyclohexyl]methyl]guanidine;hydroiodide?
The InChIKey is BMRYDGSZGTVFSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F3N3.HI/c1-15-10(16-2)17-7-8-4-3-5-9(6-8)11(12,13)14;/h8-9H,3-7H2,1-2H3,(H2,15,16,17);1H.
What are the key properties of 1,2-dimethyl-3-[[3-(trifluoromethyl)cyclohexyl]methyl]guanidine;hydroiodide?
1,2-dimethyl-3-[[3-(trifluoromethyl)cyclohexyl]methyl]guanidine;hydroiodide has a molecular weight of 379.21 g/mol, XLogP of 2.77, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-3-[[3-(trifluoromethyl)cyclohexyl]methyl]guanidine;hydroiodide is sourced from PubChem (CID 86778670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).