About 2-[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]amino]-2-methylpropanoic acid
2-[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]amino]-2-methylpropanoic acid (PubChem CID 86779598) has the molecular formula C18H24N2O4
and a molecular weight of 332.40 g/mol. Its IUPAC name is 2-[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]amino]-2-methylpropanoic acid.
Molecular Properties
| Compound Name | 2-[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]amino]-2-methylpropanoic acid |
| PubChem CID | 86779598 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 2-[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]amino]-2-methylpropanoic acid |
| SMILES | COCCn1c(C)c(C)c2cc(C(=O)NC(C)(C)C(=O)O)ccc21 |
| InChI | InChI=1S/C18H24N2O4/c1-11-12(2)20(8-9-24-5)15-7-6-13(10-14(11)15)16(21)19-18(3,4)17(22)23/h6-7,10H,8-9H2,1-5H3,(H,19,21)(H,22,23) |
| InChIKey | GCDXTBGNMBVUGI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 2-[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]amino]-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]amino]-2-methylpropanoic acid?
The IUPAC name of 2-[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]amino]-2-methylpropanoic acid (CID 86779598) is 2-[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]amino]-2-methylpropanoic acid.
What is the SMILES notation for 2-[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]amino]-2-methylpropanoic acid?
The canonical SMILES for 2-[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]amino]-2-methylpropanoic acid is COCCn1c(C)c(C)c2cc(C(=O)NC(C)(C)C(=O)O)ccc21.
What is the InChIKey of 2-[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]amino]-2-methylpropanoic acid?
The InChIKey is GCDXTBGNMBVUGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O4/c1-11-12(2)20(8-9-24-5)15-7-6-13(10-14(11)15)16(21)19-18(3,4)17(22)23/h6-7,10H,8-9H2,1-5H3,(H,19,21)(H,22,23).
What are the key properties of 2-[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]amino]-2-methylpropanoic acid?
2-[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]amino]-2-methylpropanoic acid has a molecular weight of 332.40 g/mol, XLogP of 2.50, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]amino]-2-methylpropanoic acid is sourced from PubChem (CID 86779598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).