C11H20ClIN4O2S2 — CID 86780843
2-[2-[(5-chlorothiophen-2-yl)sulfonylamino]ethyl]-1,1,3,3-tetramethylguanidine;hydroiodide (PubChem CID 86780843) has the molecular formula C11H20ClIN4O2S2 and a molecular weight of 466.80 g/mol. Its IUPAC name is 2-[2-[(5-chlorothiophen-2-yl)sulfonylamino]ethyl]-1,1,3,3-tetramethylguanidine;hydroiodide.
| Compound Name | 2-[2-[(5-chlorothiophen-2-yl)sulfonylamino]ethyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 86780843 |
| Molecular Formula | C11H20ClIN4O2S2 |
| Molecular Weight | 466.80 g/mol |
| Exact Mass | 465.98 |
| IUPAC Name | 2-[2-[(5-chlorothiophen-2-yl)sulfonylamino]ethyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
| SMILES | CN(C)C(=NCCNS(=O)(=O)c1ccc(Cl)s1)N(C)C.I |
| InChI | InChI=1S/C11H19ClN4O2S2.HI/c1-15(2)11(16(3)4)13-7-8-14-20(17,18)10-6-5-9(12)19-10;/h5-6,14H,7-8H2,1-4H3;1H |
| InChIKey | FYYJIULSTDGCJI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.80 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|