C13H21IN4O2 — CID 86781282
1,3-diethyl-2-[2-(3-nitrophenyl)ethyl]guanidine;hydroiodide (PubChem CID 86781282) has the molecular formula C13H21IN4O2 and a molecular weight of 392.24 g/mol. Its IUPAC name is 1,3-diethyl-2-[2-(3-nitrophenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1,3-diethyl-2-[2-(3-nitrophenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 86781282 |
| Molecular Formula | C13H21IN4O2 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 1,3-diethyl-2-[2-(3-nitrophenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCNC(=NCCc1cccc([N+](=O)[O-])c1)NCC.I |
| InChI | InChI=1S/C13H20N4O2.HI/c1-3-14-13(15-4-2)16-9-8-11-6-5-7-12(10-11)17(18)19;/h5-7,10H,3-4,8-9H2,1-2H3,(H2,14,15,16);1H |
| InChIKey | VFVQHBUTKFQFNY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 79.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|