About N-(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)-5-propan-2-yl-1,2-oxazole-3-carboxamide
N-(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)-5-propan-2-yl-1,2-oxazole-3-carboxamide (PubChem CID 86781581) has the molecular formula C17H19N5O3
and a molecular weight of 341.37 g/mol. Its IUPAC name is N-(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)-5-propan-2-yl-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)-5-propan-2-yl-1,2-oxazole-3-carboxamide |
| PubChem CID | 86781581 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | N-(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)-5-propan-2-yl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1nn(C)c(Oc2cccnc2)c1NC(=O)c1cc(C(C)C)on1 |
| InChI | InChI=1S/C17H19N5O3/c1-10(2)14-8-13(21-25-14)16(23)19-15-11(3)20-22(4)17(15)24-12-6-5-7-18-9-12/h5-10H,1-4H3,(H,19,23) |
| InChIKey | WITFDZNRKSTTJQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)-5-propan-2-yl-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)-5-propan-2-yl-1,2-oxazole-3-carboxamide?
The IUPAC name of N-(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)-5-propan-2-yl-1,2-oxazole-3-carboxamide (CID 86781581) is N-(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)-5-propan-2-yl-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)-5-propan-2-yl-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)-5-propan-2-yl-1,2-oxazole-3-carboxamide is Cc1nn(C)c(Oc2cccnc2)c1NC(=O)c1cc(C(C)C)on1.
What is the InChIKey of N-(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)-5-propan-2-yl-1,2-oxazole-3-carboxamide?
The InChIKey is WITFDZNRKSTTJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N5O3/c1-10(2)14-8-13(21-25-14)16(23)19-15-11(3)20-22(4)17(15)24-12-6-5-7-18-9-12/h5-10H,1-4H3,(H,19,23).
What are the key properties of N-(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)-5-propan-2-yl-1,2-oxazole-3-carboxamide?
N-(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)-5-propan-2-yl-1,2-oxazole-3-carboxamide has a molecular weight of 341.37 g/mol, XLogP of 3.28, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-dimethyl-5-pyridin-3-yloxypyrazol-4-yl)-5-propan-2-yl-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 86781581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).