C17H24N2O3 — CID 86781737
N'-(3,5-dimethoxyphenyl)-N-[(2,5-dimethylfuran-3-yl)methyl]ethane-1,2-diamine (PubChem CID 86781737) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is N'-(3,5-dimethoxyphenyl)-N-[(2,5-dimethylfuran-3-yl)methyl]ethane-1,2-diamine.
| Compound Name | N'-(3,5-dimethoxyphenyl)-N-[(2,5-dimethylfuran-3-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 86781737 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N'-(3,5-dimethoxyphenyl)-N-[(2,5-dimethylfuran-3-yl)methyl]ethane-1,2-diamine |
| SMILES | COc1cc(NCCNCc2cc(C)oc2C)cc(OC)c1 |
| InChI | InChI=1S/C17H24N2O3/c1-12-7-14(13(2)22-12)11-18-5-6-19-15-8-16(20-3)10-17(9-15)21-4/h7-10,18-19H,5-6,11H2,1-4H3 |
| InChIKey | IKGRJFWTZLOSSE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 55.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|