C15H23FN2O3S — CID 86781745
2-tert-butylsulfonyl-N-[4-fluoro-2-(propan-2-ylamino)phenyl]acetamide (PubChem CID 86781745) has the molecular formula C15H23FN2O3S and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-tert-butylsulfonyl-N-[4-fluoro-2-(propan-2-ylamino)phenyl]acetamide.
| Compound Name | 2-tert-butylsulfonyl-N-[4-fluoro-2-(propan-2-ylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 86781745 |
| Molecular Formula | C15H23FN2O3S |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 2-tert-butylsulfonyl-N-[4-fluoro-2-(propan-2-ylamino)phenyl]acetamide |
| SMILES | CC(C)Nc1cc(F)ccc1NC(=O)CS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C15H23FN2O3S/c1-10(2)17-13-8-11(16)6-7-12(13)18-14(19)9-22(20,21)15(3,4)5/h6-8,10,17H,9H2,1-5H3,(H,18,19) |
| InChIKey | APYCOTQHKHZIDR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |