C14H19NO — CID 86781785
(3R)-1-[(Z)-2-methyl-3-phenylprop-2-enyl]pyrrolidin-3-ol (PubChem CID 86781785) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is (3R)-1-[(Z)-2-methyl-3-phenylprop-2-enyl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[(Z)-2-methyl-3-phenylprop-2-enyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 86781785 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (3R)-1-[(Z)-2-methyl-3-phenylprop-2-enyl]pyrrolidin-3-ol |
| SMILES | C/C(=C/c1ccccc1)CN1CC[C@@H](O)C1 |
| InChI | InChI=1S/C14H19NO/c1-12(9-13-5-3-2-4-6-13)10-15-8-7-14(16)11-15/h2-6,9,14,16H,7-8,10-11H2,1H3/b12-9-/t14-/m1/s1 |
| InChIKey | FNADMRYQKHMPLM-FWLQQBITSA-N |
| XLogP | 2.16 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |