C17H20N4O — CID 86782096
5-(1-cyclopropyl-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl)pyridine-2-carbonitrile (PubChem CID 86782096) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is 5-(1-cyclopropyl-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl)pyridine-2-carbonitrile.
| Compound Name | 5-(1-cyclopropyl-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 86782096 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 5-(1-cyclopropyl-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl)pyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(N2CCC3C(CCC(=O)N3C3CC3)C2)cn1 |
| InChI | InChI=1S/C17H20N4O/c18-9-13-2-3-15(10-19-13)20-8-7-16-12(11-20)1-6-17(22)21(16)14-4-5-14/h2-3,10,12,14,16H,1,4-8,11H2 |
| InChIKey | KNMDCVHUHAWNJU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |