About 3-methylbut-2-enyl 1-phenyl-1,2,4-triazole-3-carboxylate
3-methylbut-2-enyl 1-phenyl-1,2,4-triazole-3-carboxylate (PubChem CID 86782167) has the molecular formula C14H15N3O2
and a molecular weight of 257.29 g/mol. Its IUPAC name is 3-methylbut-2-enyl 1-phenyl-1,2,4-triazole-3-carboxylate.
Molecular Properties
| Compound Name | 3-methylbut-2-enyl 1-phenyl-1,2,4-triazole-3-carboxylate |
| PubChem CID | 86782167 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 3-methylbut-2-enyl 1-phenyl-1,2,4-triazole-3-carboxylate |
| SMILES | CC(C)=CCOC(=O)c1ncn(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H15N3O2/c1-11(2)8-9-19-14(18)13-15-10-17(16-13)12-6-4-3-5-7-12/h3-8,10H,9H2,1-2H3 |
| InChIKey | OXDZOIODGQUPDH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbut-2-enyl 1-phenyl-1,2,4-triazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbut-2-enyl 1-phenyl-1,2,4-triazole-3-carboxylate?
The IUPAC name of 3-methylbut-2-enyl 1-phenyl-1,2,4-triazole-3-carboxylate (CID 86782167) is 3-methylbut-2-enyl 1-phenyl-1,2,4-triazole-3-carboxylate.
What is the SMILES notation for 3-methylbut-2-enyl 1-phenyl-1,2,4-triazole-3-carboxylate?
The canonical SMILES for 3-methylbut-2-enyl 1-phenyl-1,2,4-triazole-3-carboxylate is CC(C)=CCOC(=O)c1ncn(-c2ccccc2)n1.
What is the InChIKey of 3-methylbut-2-enyl 1-phenyl-1,2,4-triazole-3-carboxylate?
The InChIKey is OXDZOIODGQUPDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O2/c1-11(2)8-9-19-14(18)13-15-10-17(16-13)12-6-4-3-5-7-12/h3-8,10H,9H2,1-2H3.
What are the key properties of 3-methylbut-2-enyl 1-phenyl-1,2,4-triazole-3-carboxylate?
3-methylbut-2-enyl 1-phenyl-1,2,4-triazole-3-carboxylate has a molecular weight of 257.29 g/mol, XLogP of 2.39, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbut-2-enyl 1-phenyl-1,2,4-triazole-3-carboxylate is sourced from PubChem (CID 86782167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).