About pent-1-en-3-yl 5-fluoropyridine-3-carboxylate
pent-1-en-3-yl 5-fluoropyridine-3-carboxylate (PubChem CID 86782372) has the molecular formula C11H12FNO2
and a molecular weight of 209.22 g/mol. Its IUPAC name is pent-1-en-3-yl 5-fluoropyridine-3-carboxylate.
Molecular Properties
| Compound Name | pent-1-en-3-yl 5-fluoropyridine-3-carboxylate |
| PubChem CID | 86782372 |
| Molecular Formula | C11H12FNO2 |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | pent-1-en-3-yl 5-fluoropyridine-3-carboxylate |
| SMILES | C=CC(CC)OC(=O)c1cncc(F)c1 |
| InChI | InChI=1S/C11H12FNO2/c1-3-10(4-2)15-11(14)8-5-9(12)7-13-6-8/h3,5-7,10H,1,4H2,2H3 |
| InChIKey | SIKPDHGZTIFEIX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze pent-1-en-3-yl 5-fluoropyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-1-en-3-yl 5-fluoropyridine-3-carboxylate?
The IUPAC name of pent-1-en-3-yl 5-fluoropyridine-3-carboxylate (CID 86782372) is pent-1-en-3-yl 5-fluoropyridine-3-carboxylate.
What is the SMILES notation for pent-1-en-3-yl 5-fluoropyridine-3-carboxylate?
The canonical SMILES for pent-1-en-3-yl 5-fluoropyridine-3-carboxylate is C=CC(CC)OC(=O)c1cncc(F)c1.
What is the InChIKey of pent-1-en-3-yl 5-fluoropyridine-3-carboxylate?
The InChIKey is SIKPDHGZTIFEIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FNO2/c1-3-10(4-2)15-11(14)8-5-9(12)7-13-6-8/h3,5-7,10H,1,4H2,2H3.
What are the key properties of pent-1-en-3-yl 5-fluoropyridine-3-carboxylate?
pent-1-en-3-yl 5-fluoropyridine-3-carboxylate has a molecular weight of 209.22 g/mol, XLogP of 2.34, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pent-1-en-3-yl 5-fluoropyridine-3-carboxylate is sourced from PubChem (CID 86782372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).