C16H21N3O4 — CID 86783021
5,5-dimethyl-3-[[2-(oxan-4-yloxy)-4-pyridinyl]methyl]imidazolidine-2,4-dione (PubChem CID 86783021) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 5,5-dimethyl-3-[[2-(oxan-4-yloxy)-4-pyridinyl]methyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[[2-(oxan-4-yloxy)-4-pyridinyl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 86783021 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 5,5-dimethyl-3-[[2-(oxan-4-yloxy)-4-pyridinyl]methyl]imidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(Cc2ccnc(OC3CCOCC3)c2)C1=O |
| InChI | InChI=1S/C16H21N3O4/c1-16(2)14(20)19(15(21)18-16)10-11-3-6-17-13(9-11)23-12-4-7-22-8-5-12/h3,6,9,12H,4-5,7-8,10H2,1-2H3,(H,18,21) |
| InChIKey | KSDSJUYUALEOOX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|