About 4-acetyl-N-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide
4-acetyl-N-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide (PubChem CID 86783275) has the molecular formula C13H14F3NO3
and a molecular weight of 289.25 g/mol. Its IUPAC name is 4-acetyl-N-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide.
Molecular Properties
| Compound Name | 4-acetyl-N-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide |
| PubChem CID | 86783275 |
| Molecular Formula | C13H14F3NO3 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 4-acetyl-N-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide |
| SMILES | CC(=O)c1ccc(C(=O)N(C)CC(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H14F3NO3/c1-8(18)9-3-5-10(6-4-9)12(20)17(2)7-11(19)13(14,15)16/h3-6,11,19H,7H2,1-2H3 |
| InChIKey | UTHUXEFBWRTBJY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-acetyl-N-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-N-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide?
The IUPAC name of 4-acetyl-N-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide (CID 86783275) is 4-acetyl-N-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide.
What is the SMILES notation for 4-acetyl-N-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide?
The canonical SMILES for 4-acetyl-N-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide is CC(=O)c1ccc(C(=O)N(C)CC(O)C(F)(F)F)cc1.
What is the InChIKey of 4-acetyl-N-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide?
The InChIKey is UTHUXEFBWRTBJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F3NO3/c1-8(18)9-3-5-10(6-4-9)12(20)17(2)7-11(19)13(14,15)16/h3-6,11,19H,7H2,1-2H3.
What are the key properties of 4-acetyl-N-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide?
4-acetyl-N-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide has a molecular weight of 289.25 g/mol, XLogP of 1.88, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-N-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide is sourced from PubChem (CID 86783275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).