C14H15F2N3O2 — CID 86783593
3-(2,4-difluorophenyl)-N-[1-(1,2,4-oxadiazol-3-yl)ethyl]butanamide (PubChem CID 86783593) has the molecular formula C14H15F2N3O2 and a molecular weight of 295.29 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-N-[1-(1,2,4-oxadiazol-3-yl)ethyl]butanamide.
| Compound Name | 3-(2,4-difluorophenyl)-N-[1-(1,2,4-oxadiazol-3-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 86783593 |
| Molecular Formula | C14H15F2N3O2 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 3-(2,4-difluorophenyl)-N-[1-(1,2,4-oxadiazol-3-yl)ethyl]butanamide |
| SMILES | CC(CC(=O)NC(C)c1ncon1)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H15F2N3O2/c1-8(11-4-3-10(15)6-12(11)16)5-13(20)18-9(2)14-17-7-21-19-14/h3-4,6-9H,5H2,1-2H3,(H,18,20) |
| InChIKey | ZXTUEPHLDSNSQM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |