About 5-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)oxy]pyridine-3-carboxamide
5-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)oxy]pyridine-3-carboxamide (PubChem CID 86783734) has the molecular formula C11H10N4O2S
and a molecular weight of 262.29 g/mol. Its IUPAC name is 5-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)oxy]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 5-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)oxy]pyridine-3-carboxamide |
| PubChem CID | 86783734 |
| Molecular Formula | C11H10N4O2S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 5-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)oxy]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cncc(Oc2nc(C3CC3)ns2)c1 |
| InChI | InChI=1S/C11H10N4O2S/c12-9(16)7-3-8(5-13-4-7)17-11-14-10(15-18-11)6-1-2-6/h3-6H,1-2H2,(H2,12,16) |
| InChIKey | YOJGJCMIWYBTAL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)oxy]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)oxy]pyridine-3-carboxamide?
The IUPAC name of 5-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)oxy]pyridine-3-carboxamide (CID 86783734) is 5-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)oxy]pyridine-3-carboxamide.
What is the SMILES notation for 5-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)oxy]pyridine-3-carboxamide?
The canonical SMILES for 5-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)oxy]pyridine-3-carboxamide is NC(=O)c1cncc(Oc2nc(C3CC3)ns2)c1.
What is the InChIKey of 5-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)oxy]pyridine-3-carboxamide?
The InChIKey is YOJGJCMIWYBTAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4O2S/c12-9(16)7-3-8(5-13-4-7)17-11-14-10(15-18-11)6-1-2-6/h3-6H,1-2H2,(H2,12,16).
What are the key properties of 5-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)oxy]pyridine-3-carboxamide?
5-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)oxy]pyridine-3-carboxamide has a molecular weight of 262.29 g/mol, XLogP of 1.70, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)oxy]pyridine-3-carboxamide is sourced from PubChem (CID 86783734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).