About methyl 2-[[1-(4-methyl-1,3-thiazol-2-yl)cyclopentyl]carbamoyl]cyclopentane-1-carboxylate
methyl 2-[[1-(4-methyl-1,3-thiazol-2-yl)cyclopentyl]carbamoyl]cyclopentane-1-carboxylate (PubChem CID 86783848) has the molecular formula C17H24N2O3S
and a molecular weight of 336.46 g/mol. Its IUPAC name is methyl 2-[[1-(4-methyl-1,3-thiazol-2-yl)cyclopentyl]carbamoyl]cyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[[1-(4-methyl-1,3-thiazol-2-yl)cyclopentyl]carbamoyl]cyclopentane-1-carboxylate |
| PubChem CID | 86783848 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | methyl 2-[[1-(4-methyl-1,3-thiazol-2-yl)cyclopentyl]carbamoyl]cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1CCCC1C(=O)NC1(c2nc(C)cs2)CCCC1 |
| InChI | InChI=1S/C17H24N2O3S/c1-11-10-23-16(18-11)17(8-3-4-9-17)19-14(20)12-6-5-7-13(12)15(21)22-2/h10,12-13H,3-9H2,1-2H3,(H,19,20) |
| InChIKey | KJCYCIVSPPPQSY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[[1-(4-methyl-1,3-thiazol-2-yl)cyclopentyl]carbamoyl]cyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[1-(4-methyl-1,3-thiazol-2-yl)cyclopentyl]carbamoyl]cyclopentane-1-carboxylate?
The IUPAC name of methyl 2-[[1-(4-methyl-1,3-thiazol-2-yl)cyclopentyl]carbamoyl]cyclopentane-1-carboxylate (CID 86783848) is methyl 2-[[1-(4-methyl-1,3-thiazol-2-yl)cyclopentyl]carbamoyl]cyclopentane-1-carboxylate.
What is the SMILES notation for methyl 2-[[1-(4-methyl-1,3-thiazol-2-yl)cyclopentyl]carbamoyl]cyclopentane-1-carboxylate?
The canonical SMILES for methyl 2-[[1-(4-methyl-1,3-thiazol-2-yl)cyclopentyl]carbamoyl]cyclopentane-1-carboxylate is COC(=O)C1CCCC1C(=O)NC1(c2nc(C)cs2)CCCC1.
What is the InChIKey of methyl 2-[[1-(4-methyl-1,3-thiazol-2-yl)cyclopentyl]carbamoyl]cyclopentane-1-carboxylate?
The InChIKey is KJCYCIVSPPPQSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O3S/c1-11-10-23-16(18-11)17(8-3-4-9-17)19-14(20)12-6-5-7-13(12)15(21)22-2/h10,12-13H,3-9H2,1-2H3,(H,19,20).
What are the key properties of methyl 2-[[1-(4-methyl-1,3-thiazol-2-yl)cyclopentyl]carbamoyl]cyclopentane-1-carboxylate?
methyl 2-[[1-(4-methyl-1,3-thiazol-2-yl)cyclopentyl]carbamoyl]cyclopentane-1-carboxylate has a molecular weight of 336.46 g/mol, XLogP of 2.93, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[1-(4-methyl-1,3-thiazol-2-yl)cyclopentyl]carbamoyl]cyclopentane-1-carboxylate is sourced from PubChem (CID 86783848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).