C19H25ClN2O2 — CID 86784454
2-amino-N-methyl-2-phenyl-N-[(3-propan-2-yloxyphenyl)methyl]acetamide;hydrochloride (PubChem CID 86784454) has the molecular formula C19H25ClN2O2 and a molecular weight of 348.87 g/mol. Its IUPAC name is 2-amino-N-methyl-2-phenyl-N-[(3-propan-2-yloxyphenyl)methyl]acetamide;hydrochloride.
| Compound Name | 2-amino-N-methyl-2-phenyl-N-[(3-propan-2-yloxyphenyl)methyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 86784454 |
| Molecular Formula | C19H25ClN2O2 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 2-amino-N-methyl-2-phenyl-N-[(3-propan-2-yloxyphenyl)methyl]acetamide;hydrochloride |
| SMILES | CC(C)Oc1cccc(CN(C)C(=O)C(N)c2ccccc2)c1.Cl |
| InChI | InChI=1S/C19H24N2O2.ClH/c1-14(2)23-17-11-7-8-15(12-17)13-21(3)19(22)18(20)16-9-5-4-6-10-16;/h4-12,14,18H,13,20H2,1-3H3;1H |
| InChIKey | LDVABKYDFJLOFQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |