About 1-(3,5-diethyl-1-methylpyrazol-4-yl)sulfonyl-1,4-diazepane
1-(3,5-diethyl-1-methylpyrazol-4-yl)sulfonyl-1,4-diazepane (PubChem CID 86784564) has the molecular formula C13H24N4O2S
and a molecular weight of 300.43 g/mol. Its IUPAC name is 1-(3,5-diethyl-1-methylpyrazol-4-yl)sulfonyl-1,4-diazepane.
Molecular Properties
| Compound Name | 1-(3,5-diethyl-1-methylpyrazol-4-yl)sulfonyl-1,4-diazepane |
| PubChem CID | 86784564 |
| Molecular Formula | C13H24N4O2S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 1-(3,5-diethyl-1-methylpyrazol-4-yl)sulfonyl-1,4-diazepane |
| SMILES | CCc1nn(C)c(CC)c1S(=O)(=O)N1CCCNCC1 |
| InChI | InChI=1S/C13H24N4O2S/c1-4-11-13(12(5-2)16(3)15-11)20(18,19)17-9-6-7-14-8-10-17/h14H,4-10H2,1-3H3 |
| InChIKey | MUTOYMJCMYPOJA-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(3,5-diethyl-1-methylpyrazol-4-yl)sulfonyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-diethyl-1-methylpyrazol-4-yl)sulfonyl-1,4-diazepane?
The IUPAC name of 1-(3,5-diethyl-1-methylpyrazol-4-yl)sulfonyl-1,4-diazepane (CID 86784564) is 1-(3,5-diethyl-1-methylpyrazol-4-yl)sulfonyl-1,4-diazepane.
What is the SMILES notation for 1-(3,5-diethyl-1-methylpyrazol-4-yl)sulfonyl-1,4-diazepane?
The canonical SMILES for 1-(3,5-diethyl-1-methylpyrazol-4-yl)sulfonyl-1,4-diazepane is CCc1nn(C)c(CC)c1S(=O)(=O)N1CCCNCC1.
What is the InChIKey of 1-(3,5-diethyl-1-methylpyrazol-4-yl)sulfonyl-1,4-diazepane?
The InChIKey is MUTOYMJCMYPOJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N4O2S/c1-4-11-13(12(5-2)16(3)15-11)20(18,19)17-9-6-7-14-8-10-17/h14H,4-10H2,1-3H3.
What are the key properties of 1-(3,5-diethyl-1-methylpyrazol-4-yl)sulfonyl-1,4-diazepane?
1-(3,5-diethyl-1-methylpyrazol-4-yl)sulfonyl-1,4-diazepane has a molecular weight of 300.43 g/mol, XLogP of 0.53, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-diethyl-1-methylpyrazol-4-yl)sulfonyl-1,4-diazepane is sourced from PubChem (CID 86784564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).