About N-(1-aminopropan-2-yl)-N,4,5-trimethylthiophene-2-sulfonamide
N-(1-aminopropan-2-yl)-N,4,5-trimethylthiophene-2-sulfonamide (PubChem CID 86784631) has the molecular formula C10H18N2O2S2
and a molecular weight of 262.40 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-N,4,5-trimethylthiophene-2-sulfonamide.
Molecular Properties
| Compound Name | N-(1-aminopropan-2-yl)-N,4,5-trimethylthiophene-2-sulfonamide |
| PubChem CID | 86784631 |
| Molecular Formula | C10H18N2O2S2 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | N-(1-aminopropan-2-yl)-N,4,5-trimethylthiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)C(C)CN)sc1C |
| InChI | InChI=1S/C10H18N2O2S2/c1-7-5-10(15-9(7)3)16(13,14)12(4)8(2)6-11/h5,8H,6,11H2,1-4H3 |
| InChIKey | KLBPVXVVWMSQBU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1-aminopropan-2-yl)-N,4,5-trimethylthiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-aminopropan-2-yl)-N,4,5-trimethylthiophene-2-sulfonamide?
The IUPAC name of N-(1-aminopropan-2-yl)-N,4,5-trimethylthiophene-2-sulfonamide (CID 86784631) is N-(1-aminopropan-2-yl)-N,4,5-trimethylthiophene-2-sulfonamide.
What is the SMILES notation for N-(1-aminopropan-2-yl)-N,4,5-trimethylthiophene-2-sulfonamide?
The canonical SMILES for N-(1-aminopropan-2-yl)-N,4,5-trimethylthiophene-2-sulfonamide is Cc1cc(S(=O)(=O)N(C)C(C)CN)sc1C.
What is the InChIKey of N-(1-aminopropan-2-yl)-N,4,5-trimethylthiophene-2-sulfonamide?
The InChIKey is KLBPVXVVWMSQBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2S2/c1-7-5-10(15-9(7)3)16(13,14)12(4)8(2)6-11/h5,8H,6,11H2,1-4H3.
What are the key properties of N-(1-aminopropan-2-yl)-N,4,5-trimethylthiophene-2-sulfonamide?
N-(1-aminopropan-2-yl)-N,4,5-trimethylthiophene-2-sulfonamide has a molecular weight of 262.40 g/mol, XLogP of 1.33, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-aminopropan-2-yl)-N,4,5-trimethylthiophene-2-sulfonamide is sourced from PubChem (CID 86784631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).