About N-(1-aminopropan-2-yl)-3,5-diethyl-N,1-dimethylpyrazole-4-sulfonamide
N-(1-aminopropan-2-yl)-3,5-diethyl-N,1-dimethylpyrazole-4-sulfonamide (PubChem CID 86784633) has the molecular formula C12H24N4O2S
and a molecular weight of 288.42 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-3,5-diethyl-N,1-dimethylpyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(1-aminopropan-2-yl)-3,5-diethyl-N,1-dimethylpyrazole-4-sulfonamide |
| PubChem CID | 86784633 |
| Molecular Formula | C12H24N4O2S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | N-(1-aminopropan-2-yl)-3,5-diethyl-N,1-dimethylpyrazole-4-sulfonamide |
| SMILES | CCc1nn(C)c(CC)c1S(=O)(=O)N(C)C(C)CN |
| InChI | InChI=1S/C12H24N4O2S/c1-6-10-12(11(7-2)15(4)14-10)19(17,18)16(5)9(3)8-13/h9H,6-8,13H2,1-5H3 |
| InChIKey | RSQBHZDLJIACEQ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1-aminopropan-2-yl)-3,5-diethyl-N,1-dimethylpyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-aminopropan-2-yl)-3,5-diethyl-N,1-dimethylpyrazole-4-sulfonamide?
The IUPAC name of N-(1-aminopropan-2-yl)-3,5-diethyl-N,1-dimethylpyrazole-4-sulfonamide (CID 86784633) is N-(1-aminopropan-2-yl)-3,5-diethyl-N,1-dimethylpyrazole-4-sulfonamide.
What is the SMILES notation for N-(1-aminopropan-2-yl)-3,5-diethyl-N,1-dimethylpyrazole-4-sulfonamide?
The canonical SMILES for N-(1-aminopropan-2-yl)-3,5-diethyl-N,1-dimethylpyrazole-4-sulfonamide is CCc1nn(C)c(CC)c1S(=O)(=O)N(C)C(C)CN.
What is the InChIKey of N-(1-aminopropan-2-yl)-3,5-diethyl-N,1-dimethylpyrazole-4-sulfonamide?
The InChIKey is RSQBHZDLJIACEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N4O2S/c1-6-10-12(11(7-2)15(4)14-10)19(17,18)16(5)9(3)8-13/h9H,6-8,13H2,1-5H3.
What are the key properties of N-(1-aminopropan-2-yl)-3,5-diethyl-N,1-dimethylpyrazole-4-sulfonamide?
N-(1-aminopropan-2-yl)-3,5-diethyl-N,1-dimethylpyrazole-4-sulfonamide has a molecular weight of 288.42 g/mol, XLogP of 0.51, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-aminopropan-2-yl)-3,5-diethyl-N,1-dimethylpyrazole-4-sulfonamide is sourced from PubChem (CID 86784633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).