C18H31N5O2 — CID 86784788
tert-butyl 2-[1-[(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)amino]ethyl]pyrrolidine-1-carboxylate (PubChem CID 86784788) has the molecular formula C18H31N5O2 and a molecular weight of 349.48 g/mol. Its IUPAC name is tert-butyl 2-[1-[(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)amino]ethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[1-[(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)amino]ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 86784788 |
| Molecular Formula | C18H31N5O2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | tert-butyl 2-[1-[(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)amino]ethyl]pyrrolidine-1-carboxylate |
| SMILES | Cc1nc2n(n1)CCCC2NC(C)C1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H31N5O2/c1-12(15-9-7-10-22(15)17(24)25-18(3,4)5)19-14-8-6-11-23-16(14)20-13(2)21-23/h12,14-15,19H,6-11H2,1-5H3 |
| InChIKey | DSKPNXWXOUYROV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |