About (1E)-1-(3,4-diphenyl-1,3-thiazol-2-ylidene)propan-2-one
(1E)-1-(3,4-diphenyl-1,3-thiazol-2-ylidene)propan-2-one (PubChem CID 867848) has the molecular formula C18H15NOS
and a molecular weight of 293.39 g/mol. Its IUPAC name is (1E)-1-(3,4-diphenyl-1,3-thiazol-2-ylidene)propan-2-one.
Molecular Properties
| Compound Name | (1E)-1-(3,4-diphenyl-1,3-thiazol-2-ylidene)propan-2-one |
| PubChem CID | 867848 |
| Molecular Formula | C18H15NOS |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | (1E)-1-(3,4-diphenyl-1,3-thiazol-2-ylidene)propan-2-one |
| SMILES | CC(=O)/C=C1/SC=C(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C18H15NOS/c1-14(20)12-18-19(16-10-6-3-7-11-16)17(13-21-18)15-8-4-2-5-9-15/h2-13H,1H3/b18-12+ |
| InChIKey | RMSPCJAJCDESRN-LDADJPATSA-N |
| XLogP | 4.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-(3,4-diphenyl-1,3-thiazol-2-ylidene)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-(3,4-diphenyl-1,3-thiazol-2-ylidene)propan-2-one?
The IUPAC name of (1E)-1-(3,4-diphenyl-1,3-thiazol-2-ylidene)propan-2-one (CID 867848) is (1E)-1-(3,4-diphenyl-1,3-thiazol-2-ylidene)propan-2-one.
What is the SMILES notation for (1E)-1-(3,4-diphenyl-1,3-thiazol-2-ylidene)propan-2-one?
The canonical SMILES for (1E)-1-(3,4-diphenyl-1,3-thiazol-2-ylidene)propan-2-one is CC(=O)/C=C1/SC=C(c2ccccc2)N1c1ccccc1.
What is the InChIKey of (1E)-1-(3,4-diphenyl-1,3-thiazol-2-ylidene)propan-2-one?
The InChIKey is RMSPCJAJCDESRN-LDADJPATSA-N. The full InChI is InChI=1S/C18H15NOS/c1-14(20)12-18-19(16-10-6-3-7-11-16)17(13-21-18)15-8-4-2-5-9-15/h2-13H,1H3/b18-12+.
What are the key properties of (1E)-1-(3,4-diphenyl-1,3-thiazol-2-ylidene)propan-2-one?
(1E)-1-(3,4-diphenyl-1,3-thiazol-2-ylidene)propan-2-one has a molecular weight of 293.39 g/mol, XLogP of 4.67, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-(3,4-diphenyl-1,3-thiazol-2-ylidene)propan-2-one is sourced from PubChem (CID 867848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).