C14H17F4N3O2 — CID 86785018
4-methyl-3-[4-(2,2,3,3-tetrafluoropropyl)piperazine-1-carbonyl]-1H-pyridin-2-one (PubChem CID 86785018) has the molecular formula C14H17F4N3O2 and a molecular weight of 335.30 g/mol. Its IUPAC name is 4-methyl-3-[4-(2,2,3,3-tetrafluoropropyl)piperazine-1-carbonyl]-1H-pyridin-2-one.
| Compound Name | 4-methyl-3-[4-(2,2,3,3-tetrafluoropropyl)piperazine-1-carbonyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 86785018 |
| Molecular Formula | C14H17F4N3O2 |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 4-methyl-3-[4-(2,2,3,3-tetrafluoropropyl)piperazine-1-carbonyl]-1H-pyridin-2-one |
| SMILES | Cc1cc[nH]c(=O)c1C(=O)N1CCN(CC(F)(F)C(F)F)CC1 |
| InChI | InChI=1S/C14H17F4N3O2/c1-9-2-3-19-11(22)10(9)12(23)21-6-4-20(5-7-21)8-14(17,18)13(15)16/h2-3,13H,4-8H2,1H3,(H,19,22) |
| InChIKey | BFHMKFIRWXIXJT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|