About 1-(2-methoxyethyl)-4-(1,3-thiazol-5-ylmethyl)piperazin-2-one
1-(2-methoxyethyl)-4-(1,3-thiazol-5-ylmethyl)piperazin-2-one (PubChem CID 86785266) has the molecular formula C11H17N3O2S
and a molecular weight of 255.34 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-4-(1,3-thiazol-5-ylmethyl)piperazin-2-one.
Molecular Properties
| Compound Name | 1-(2-methoxyethyl)-4-(1,3-thiazol-5-ylmethyl)piperazin-2-one |
| PubChem CID | 86785266 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 1-(2-methoxyethyl)-4-(1,3-thiazol-5-ylmethyl)piperazin-2-one |
| SMILES | COCCN1CCN(Cc2cncs2)CC1=O |
| InChI | InChI=1S/C11H17N3O2S/c1-16-5-4-14-3-2-13(8-11(14)15)7-10-6-12-9-17-10/h6,9H,2-5,7-8H2,1H3 |
| InChIKey | XYMDCHCQKRJVGB-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2-methoxyethyl)-4-(1,3-thiazol-5-ylmethyl)piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxyethyl)-4-(1,3-thiazol-5-ylmethyl)piperazin-2-one?
The IUPAC name of 1-(2-methoxyethyl)-4-(1,3-thiazol-5-ylmethyl)piperazin-2-one (CID 86785266) is 1-(2-methoxyethyl)-4-(1,3-thiazol-5-ylmethyl)piperazin-2-one.
What is the SMILES notation for 1-(2-methoxyethyl)-4-(1,3-thiazol-5-ylmethyl)piperazin-2-one?
The canonical SMILES for 1-(2-methoxyethyl)-4-(1,3-thiazol-5-ylmethyl)piperazin-2-one is COCCN1CCN(Cc2cncs2)CC1=O.
What is the InChIKey of 1-(2-methoxyethyl)-4-(1,3-thiazol-5-ylmethyl)piperazin-2-one?
The InChIKey is XYMDCHCQKRJVGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O2S/c1-16-5-4-14-3-2-13(8-11(14)15)7-10-6-12-9-17-10/h6,9H,2-5,7-8H2,1H3.
What are the key properties of 1-(2-methoxyethyl)-4-(1,3-thiazol-5-ylmethyl)piperazin-2-one?
1-(2-methoxyethyl)-4-(1,3-thiazol-5-ylmethyl)piperazin-2-one has a molecular weight of 255.34 g/mol, XLogP of 0.43, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxyethyl)-4-(1,3-thiazol-5-ylmethyl)piperazin-2-one is sourced from PubChem (CID 86785266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).