C16H23N3O3S — CID 86785606
1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-pyrazol-1-ylpropan-1-one (PubChem CID 86785606) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is 1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-pyrazol-1-ylpropan-1-one.
| Compound Name | 1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-pyrazol-1-ylpropan-1-one |
|---|---|
| PubChem CID | 86785606 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-pyrazol-1-ylpropan-1-one |
| SMILES | CC1(C)[C@@H]2CC[C@]13CS(=O)(=O)N(C(=O)CCn1cccn1)[C@@H]3C2 |
| InChI | InChI=1S/C16H23N3O3S/c1-15(2)12-4-6-16(15)11-23(21,22)19(13(16)10-12)14(20)5-9-18-8-3-7-17-18/h3,7-8,12-13H,4-6,9-11H2,1-2H3/t12-,13-,16-/m1/s1 |
| InChIKey | ITEYVQFNOBPAPM-XJKCOSOUSA-N |
| XLogP | 1.64 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |